C23H26FN6O9P — CID 53372400
[7,8-dideuterio-6-[[6-deuterio-5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-3-oxo-2,2-bis(trideuteriomethyl)pyrido[3,2-b][1,4]oxazin-4-yl]methyl dihydrogen phosphate (PubChem CID 53372400) has the molecular formula C23H26FN6O9P and a molecular weight of 589.52 g/mol. Its IUPAC name is [7,8-dideuterio-6-[[6-deuterio-5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-3-oxo-2,2-bis(trideuteriomethyl)pyrido[3,2-b][1,4]oxazin-4-yl]methyl dihydrogen phosphate.
| Compound Name | [7,8-dideuterio-6-[[6-deuterio-5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-3-oxo-2,2-bis(trideuteriomethyl)pyrido[3,2-b][1,4]oxazin-4-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 53372400 |
| Molecular Formula | C23H26FN6O9P |
| Molecular Weight | 589.52 g/mol |
| Exact Mass | 589.20 |
| IUPAC Name | [7,8-dideuterio-6-[[6-deuterio-5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-3-oxo-2,2-bis(trideuteriomethyl)pyrido[3,2-b][1,4]oxazin-4-yl]methyl dihydrogen phosphate |
| SMILES | [2H]c1nc(Nc2cc(OC)c(OC)c(OC)c2)nc(Nc2nc3c(c([2H])c2[2H])OC(C([2H])([2H])[2H])(C([2H])([2H])[2H])C(=O)N3COP(=O)(O)O)c1F |
| InChI | InChI=1S/C23H26FN6O9P/c1-23(2)21(31)30(11-38-40(32,33)34)20-14(39-23)6-7-17(28-20)27-19-13(24)10-25-22(29-19)26-12-8-15(35-3)18(37-5)16(9-12)36-4/h6-10H,11H2,1-5H3,(H2,32,33,34)(H2,25,26,27,28,29)/i1D3,2D3,6D,7D,10D |
| InChIKey | GKDRMWXFWHEQQT-CEXWDZCMSA-N |
| XLogP | 3.09 |
| TPSA | 186.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|