C23H28FN8O9P — CID 90273622
diamino [6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethyl-3-oxopyrido[3,2-b][1,4]oxazin-4-yl]methyl phosphate (PubChem CID 90273622) has the molecular formula C23H28FN8O9P and a molecular weight of 610.50 g/mol. Its IUPAC name is diamino [6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethyl-3-oxopyrido[3,2-b][1,4]oxazin-4-yl]methyl phosphate.
| Compound Name | diamino [6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethyl-3-oxopyrido[3,2-b][1,4]oxazin-4-yl]methyl phosphate |
|---|---|
| PubChem CID | 90273622 |
| Molecular Formula | C23H28FN8O9P |
| Molecular Weight | 610.50 g/mol |
| Exact Mass | 610.17 |
| IUPAC Name | diamino [6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethyl-3-oxopyrido[3,2-b][1,4]oxazin-4-yl]methyl phosphate |
| SMILES | COc1cc(Nc2ncc(F)c(Nc3ccc4c(n3)N(COP(=O)(ON)ON)C(=O)C(C)(C)O4)n2)cc(OC)c1OC |
| InChI | InChI=1S/C23H28FN8O9P/c1-23(2)21(33)32(11-38-42(34,40-25)41-26)20-14(39-23)6-7-17(30-20)29-19-13(24)10-27-22(31-19)28-12-8-15(35-3)18(37-5)16(9-12)36-4/h6-10H,11,25-26H2,1-5H3,(H2,27,28,29,30,31) |
| InChIKey | XVTQBTGYDKFORK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 216.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|