C23H24FN6Na2O9P — CID 53373042
disodium;[6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-3-oxo-2,2-bis(trideuteriomethyl)pyrido[3,2-b][1,4]oxazin-4-yl]methyl phosphate (PubChem CID 53373042) has the molecular formula C23H24FN6Na2O9P and a molecular weight of 630.47 g/mol. Its IUPAC name is disodium;[6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-3-oxo-2,2-bis(trideuteriomethyl)pyrido[3,2-b][1,4]oxazin-4-yl]methyl phosphate.
| Compound Name | disodium;[6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-3-oxo-2,2-bis(trideuteriomethyl)pyrido[3,2-b][1,4]oxazin-4-yl]methyl phosphate |
|---|---|
| PubChem CID | 53373042 |
| Molecular Formula | C23H24FN6Na2O9P |
| Molecular Weight | 630.47 g/mol |
| Exact Mass | 630.15 |
| IUPAC Name | disodium;[6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-3-oxo-2,2-bis(trideuteriomethyl)pyrido[3,2-b][1,4]oxazin-4-yl]methyl phosphate |
| SMILES | [2H]C([2H])([2H])C1(C([2H])([2H])[2H])Oc2ccc(Nc3nc(Nc4cc(OC)c(OC)c(OC)c4)ncc3F)nc2N(COP(=O)([O-])[O-])C1=O.[Na+].[Na+] |
| InChI | InChI=1S/C23H26FN6O9P.2Na/c1-23(2)21(31)30(11-38-40(32,33)34)20-14(39-23)6-7-17(28-20)27-19-13(24)10-25-22(29-19)26-12-8-15(35-3)18(37-5)16(9-12)36-4;;/h6-10H,11H2,1-5H3,(H2,32,33,34)(H2,25,26,27,28,29);;/q;2*+1/p-2/i1D3,2D3;; |
| InChIKey | HSYBQXDGYCYSGA-ADBWCSELSA-L |
| XLogP | -4.16 |
| TPSA | 192.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.47 |
| LogP ≤ 5 | -4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|