C31H42FN6O8P — CID 170370406
ditert-butyl [6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethyl-3-oxopyrido[3,2-b][1,4]oxazin-4-yl]methyl phosphite (PubChem CID 170370406) has the molecular formula C31H42FN6O8P and a molecular weight of 676.68 g/mol. Its IUPAC name is ditert-butyl [6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethyl-3-oxopyrido[3,2-b][1,4]oxazin-4-yl]methyl phosphite.
| Compound Name | ditert-butyl [6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethyl-3-oxopyrido[3,2-b][1,4]oxazin-4-yl]methyl phosphite |
|---|---|
| PubChem CID | 170370406 |
| Molecular Formula | C31H42FN6O8P |
| Molecular Weight | 676.68 g/mol |
| Exact Mass | 676.28 |
| IUPAC Name | ditert-butyl [6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethyl-3-oxopyrido[3,2-b][1,4]oxazin-4-yl]methyl phosphite |
| SMILES | COc1cc(Nc2ncc(F)c(Nc3ccc4c(n3)N(COP(OC(C)(C)C)OC(C)(C)C)C(=O)C(C)(C)O4)n2)cc(OC)c1OC |
| InChI | InChI=1S/C31H42FN6O8P/c1-29(2,3)45-47(46-30(4,5)6)43-17-38-26-20(44-31(7,8)27(38)39)12-13-23(36-26)35-25-19(32)16-33-28(37-25)34-18-14-21(40-9)24(42-11)22(15-18)41-10/h12-16H,17H2,1-11H3,(H2,33,34,35,36,37) |
| InChIKey | DKKXXMSBUYNHND-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 147.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.68 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|