C21H20FN6Na2O9P — CID 53372407
disodium;[8-deuterio-6-[[2-[3,5-dihydroxy-4-(trideuteriomethoxy)anilino]-5-fluoropyrimidin-4-yl]amino]-2,2-dimethyl-3-oxopyrido[3,2-b][1,4]oxazin-4-yl]methyl phosphate (PubChem CID 53372407) has the molecular formula C21H20FN6Na2O9P and a molecular weight of 600.40 g/mol. Its IUPAC name is disodium;[8-deuterio-6-[[2-[3,5-dihydroxy-4-(trideuteriomethoxy)anilino]-5-fluoropyrimidin-4-yl]amino]-2,2-dimethyl-3-oxopyrido[3,2-b][1,4]oxazin-4-yl]methyl phosphate.
| Compound Name | disodium;[8-deuterio-6-[[2-[3,5-dihydroxy-4-(trideuteriomethoxy)anilino]-5-fluoropyrimidin-4-yl]amino]-2,2-dimethyl-3-oxopyrido[3,2-b][1,4]oxazin-4-yl]methyl phosphate |
|---|---|
| PubChem CID | 53372407 |
| Molecular Formula | C21H20FN6Na2O9P |
| Molecular Weight | 600.40 g/mol |
| Exact Mass | 600.11 |
| IUPAC Name | disodium;[8-deuterio-6-[[2-[3,5-dihydroxy-4-(trideuteriomethoxy)anilino]-5-fluoropyrimidin-4-yl]amino]-2,2-dimethyl-3-oxopyrido[3,2-b][1,4]oxazin-4-yl]methyl phosphate |
| SMILES | [2H]c1cc(Nc2nc(Nc3cc(O)c(OC([2H])([2H])[2H])c(O)c3)ncc2F)nc2c1OC(C)(C)C(=O)N2COP(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C21H22FN6O9P.2Na/c1-21(2)19(31)28(9-36-38(32,33)34)18-14(37-21)4-5-15(26-18)25-17-11(22)8-23-20(27-17)24-10-6-12(29)16(35-3)13(30)7-10;;/h4-8,29-30H,9H2,1-3H3,(H2,32,33,34)(H2,23,24,25,26,27);;/q;2*+1/p-2/i3D3,4D;; |
| InChIKey | OXVNCOZLIIGWCT-QGZWDIRTSA-L |
| XLogP | -4.77 |
| TPSA | 214.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.40 |
| LogP ≤ 5 | -4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|