C23H23FN6O5 — CID 123665831
7-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]spiro[2,5-dihydropyrido[3,2-b][1,4]oxazepine-3,1'-cyclopropane]-4-one (PubChem CID 123665831) has the molecular formula C23H23FN6O5 and a molecular weight of 482.47 g/mol. Its IUPAC name is 7-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]spiro[2,5-dihydropyrido[3,2-b][1,4]oxazepine-3,1'-cyclopropane]-4-one.
| Compound Name | 7-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]spiro[2,5-dihydropyrido[3,2-b][1,4]oxazepine-3,1'-cyclopropane]-4-one |
|---|---|
| PubChem CID | 123665831 |
| Molecular Formula | C23H23FN6O5 |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 7-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]spiro[2,5-dihydropyrido[3,2-b][1,4]oxazepine-3,1'-cyclopropane]-4-one |
| SMILES | COc1cc(Nc2ncc(F)c(Nc3ccc4c(n3)NC(=O)C3(CC3)CO4)n2)cc(OC)c1OC |
| InChI | InChI=1S/C23H23FN6O5/c1-32-15-8-12(9-16(33-2)18(15)34-3)26-22-25-10-13(24)19(30-22)27-17-5-4-14-20(28-17)29-21(31)23(6-7-23)11-35-14/h4-5,8-10H,6-7,11H2,1-3H3,(H3,25,26,27,28,29,30,31) |
| InChIKey | BKQRTJVZMCVRNX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 128.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |