C22H23FN6O5 — CID 53372534
6-[[6-deuterio-5-fluoro-2-[3,4,5-tris(trideuteriomethoxy)anilino]pyrimidin-4-yl]amino]-2,2-bis(trideuteriomethyl)-4H-pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 53372534) has the molecular formula C22H23FN6O5 and a molecular weight of 486.56 g/mol. Its IUPAC name is 6-[[6-deuterio-5-fluoro-2-[3,4,5-tris(trideuteriomethoxy)anilino]pyrimidin-4-yl]amino]-2,2-bis(trideuteriomethyl)-4H-pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 6-[[6-deuterio-5-fluoro-2-[3,4,5-tris(trideuteriomethoxy)anilino]pyrimidin-4-yl]amino]-2,2-bis(trideuteriomethyl)-4H-pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 53372534 |
| Molecular Formula | C22H23FN6O5 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | 6-[[6-deuterio-5-fluoro-2-[3,4,5-tris(trideuteriomethoxy)anilino]pyrimidin-4-yl]amino]-2,2-bis(trideuteriomethyl)-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | [2H]c1nc(Nc2cc(OC([2H])([2H])[2H])c(OC([2H])([2H])[2H])c(OC([2H])([2H])[2H])c2)nc(Nc2ccc3c(n2)NC(=O)C(C([2H])([2H])[2H])(C([2H])([2H])[2H])O3)c1F |
| InChI | InChI=1S/C22H23FN6O5/c1-22(2)20(30)28-19-13(34-22)6-7-16(27-19)26-18-12(23)10-24-21(29-18)25-11-8-14(31-3)17(33-5)15(9-11)32-4/h6-10H,1-5H3,(H3,24,25,26,27,28,29,30)/i1D3,2D3,3D3,4D3,5D3,10D |
| InChIKey | NHHQJBCNYHBUSI-MJMDQEQWSA-N |
| XLogP | 3.63 |
| TPSA | 128.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |