C25H28FN5O5 — CID 123706585
6-[[5-ethyl-3-fluoro-6-(3,4,5-trimethoxyanilino)-2-pyridinyl]amino]-2,2-dimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 123706585) has the molecular formula C25H28FN5O5 and a molecular weight of 497.53 g/mol. Its IUPAC name is 6-[[5-ethyl-3-fluoro-6-(3,4,5-trimethoxyanilino)-2-pyridinyl]amino]-2,2-dimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 6-[[5-ethyl-3-fluoro-6-(3,4,5-trimethoxyanilino)-2-pyridinyl]amino]-2,2-dimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 123706585 |
| Molecular Formula | C25H28FN5O5 |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 6-[[5-ethyl-3-fluoro-6-(3,4,5-trimethoxyanilino)-2-pyridinyl]amino]-2,2-dimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | CCc1cc(F)c(Nc2ccc3c(n2)NC(=O)C(C)(C)O3)nc1Nc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C25H28FN5O5/c1-7-13-10-15(26)22(28-19-9-8-16-23(29-19)31-24(32)25(2,3)36-16)30-21(13)27-14-11-17(33-4)20(35-6)18(12-14)34-5/h8-12H,7H2,1-6H3,(H3,27,28,29,30,31,32) |
| InChIKey | HYCZRMKSKZNNRX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 115.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |