C23H24FN7O6 — CID 71045269
1-[4-[(2,2-dimethyl-3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)amino]-5-fluoropyrimidin-2-yl]-1-(3,4,5-trimethoxyphenyl)urea (PubChem CID 71045269) has the molecular formula C23H24FN7O6 and a molecular weight of 513.49 g/mol. Its IUPAC name is 1-[4-[(2,2-dimethyl-3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)amino]-5-fluoropyrimidin-2-yl]-1-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-[4-[(2,2-dimethyl-3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)amino]-5-fluoropyrimidin-2-yl]-1-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 71045269 |
| Molecular Formula | C23H24FN7O6 |
| Molecular Weight | 513.49 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | 1-[4-[(2,2-dimethyl-3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)amino]-5-fluoropyrimidin-2-yl]-1-(3,4,5-trimethoxyphenyl)urea |
| SMILES | COc1cc(N(C(N)=O)c2ncc(F)c(Nc3ccc4c(n3)NC(=O)C(C)(C)O4)n2)cc(OC)c1OC |
| InChI | InChI=1S/C23H24FN7O6/c1-23(2)20(32)29-19-13(37-23)6-7-16(28-19)27-18-12(24)10-26-22(30-18)31(21(25)33)11-8-14(34-3)17(36-5)15(9-11)35-4/h6-10H,1-5H3,(H2,25,33)(H2,26,27,28,29,30,32) |
| InChIKey | GUSOGVKEVCGGHZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 163.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |