C31H42FN6O8P — CID 156638613
6-[[5-fluoro-2-[N-[(5-hydroxy-2,5-dimethylhexan-2-yl)oxyphosphanyloxymethyl]-3,4,5-trimethoxyanilino]pyrimidin-4-yl]amino]-2,2-dimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 156638613) has the molecular formula C31H42FN6O8P and a molecular weight of 676.68 g/mol. Its IUPAC name is 6-[[5-fluoro-2-[N-[(5-hydroxy-2,5-dimethylhexan-2-yl)oxyphosphanyloxymethyl]-3,4,5-trimethoxyanilino]pyrimidin-4-yl]amino]-2,2-dimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 6-[[5-fluoro-2-[N-[(5-hydroxy-2,5-dimethylhexan-2-yl)oxyphosphanyloxymethyl]-3,4,5-trimethoxyanilino]pyrimidin-4-yl]amino]-2,2-dimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 156638613 |
| Molecular Formula | C31H42FN6O8P |
| Molecular Weight | 676.68 g/mol |
| Exact Mass | 676.28 |
| IUPAC Name | 6-[[5-fluoro-2-[N-[(5-hydroxy-2,5-dimethylhexan-2-yl)oxyphosphanyloxymethyl]-3,4,5-trimethoxyanilino]pyrimidin-4-yl]amino]-2,2-dimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | COc1cc(N(COPOC(C)(C)CCC(C)(C)O)c2ncc(F)c(Nc3ccc4c(n3)NC(=O)C(C)(C)O4)n2)cc(OC)c1OC |
| InChI | InChI=1S/C31H42FN6O8P/c1-29(2,40)12-13-30(3,4)46-47-44-17-38(18-14-21(41-7)24(43-9)22(15-18)42-8)28-33-16-19(32)25(37-28)34-23-11-10-20-26(35-23)36-27(39)31(5,6)45-20/h10-11,14-16,40,47H,12-13,17H2,1-9H3,(H2,33,34,35,36,37,39) |
| InChIKey | UFULFIDYWPJCEH-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 158.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.68 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|