C23H27FN6NaO9P — CID 175869528
sodium;8-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-3,3,9-trimethyl-2-oxa-7-aza-5-azanidabicyclo[4.4.0]deca-1(6),7,9-trien-4-one;phosphoric acid (PubChem CID 175869528) has the molecular formula C23H27FN6NaO9P and a molecular weight of 604.46 g/mol. Its IUPAC name is sodium;8-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-3,3,9-trimethyl-2-oxa-7-aza-5-azanidabicyclo[4.4.0]deca-1(6),7,9-trien-4-one;phosphoric acid.
| Compound Name | sodium;8-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-3,3,9-trimethyl-2-oxa-7-aza-5-azanidabicyclo[4.4.0]deca-1(6),7,9-trien-4-one;phosphoric acid |
|---|---|
| PubChem CID | 175869528 |
| Molecular Formula | C23H27FN6NaO9P |
| Molecular Weight | 604.46 g/mol |
| Exact Mass | 604.15 |
| IUPAC Name | sodium;8-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-3,3,9-trimethyl-2-oxa-7-aza-5-azanidabicyclo[4.4.0]deca-1(6),7,9-trien-4-one;phosphoric acid |
| SMILES | COc1cc(Nc2ncc(F)c(Nc3nc4c(cc3C)OC(C)(C)C(=O)[N-]4)n2)cc(OC)c1OC.O=P(O)(O)O.[Na+] |
| InChI | InChI=1S/C23H25FN6O5.Na.H3O4P/c1-11-7-16-20(29-21(31)23(2,3)35-16)28-18(11)27-19-13(24)10-25-22(30-19)26-12-8-14(32-4)17(34-6)15(9-12)33-5;;1-5(2,3)4/h7-10H,1-6H3,(H3,25,26,27,28,29,30,31);;(H3,1,2,3,4)/q;+1;/p-1 |
| InChIKey | WDLNCSWVAWXQJJ-UHFFFAOYSA-M |
| XLogP | 0.61 |
| TPSA | 208.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.46 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|