C28H25N5O4 — CID 68796093
4-[2-(4-methylbenzoyl)anilino]-2-(3,4,5-trimethoxyanilino)pyrimidine-5-carbonitrile (PubChem CID 68796093) has the molecular formula C28H25N5O4 and a molecular weight of 495.54 g/mol. Its IUPAC name is 4-[2-(4-methylbenzoyl)anilino]-2-(3,4,5-trimethoxyanilino)pyrimidine-5-carbonitrile.
| Compound Name | 4-[2-(4-methylbenzoyl)anilino]-2-(3,4,5-trimethoxyanilino)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 68796093 |
| Molecular Formula | C28H25N5O4 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 4-[2-(4-methylbenzoyl)anilino]-2-(3,4,5-trimethoxyanilino)pyrimidine-5-carbonitrile |
| SMILES | COc1cc(Nc2ncc(C#N)c(Nc3ccccc3C(=O)c3ccc(C)cc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C28H25N5O4/c1-17-9-11-18(12-10-17)25(34)21-7-5-6-8-22(21)32-27-19(15-29)16-30-28(33-27)31-20-13-23(35-2)26(37-4)24(14-20)36-3/h5-14,16H,1-4H3,(H2,30,31,32,33) |
| InChIKey | TZNMFMQKKIZUGH-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 118.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|