C24H30N6O4 — CID 71812787
N-pentan-3-yl-2-[[4-(3,4,5-trimethoxyanilino)-1,3,5-triazin-2-yl]amino]benzamide (PubChem CID 71812787) has the molecular formula C24H30N6O4 and a molecular weight of 466.54 g/mol. Its IUPAC name is N-pentan-3-yl-2-[[4-(3,4,5-trimethoxyanilino)-1,3,5-triazin-2-yl]amino]benzamide.
| Compound Name | N-pentan-3-yl-2-[[4-(3,4,5-trimethoxyanilino)-1,3,5-triazin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 71812787 |
| Molecular Formula | C24H30N6O4 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | N-pentan-3-yl-2-[[4-(3,4,5-trimethoxyanilino)-1,3,5-triazin-2-yl]amino]benzamide |
| SMILES | CCC(CC)NC(=O)c1ccccc1Nc1ncnc(Nc2cc(OC)c(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C24H30N6O4/c1-6-15(7-2)27-22(31)17-10-8-9-11-18(17)29-24-26-14-25-23(30-24)28-16-12-19(32-3)21(34-5)20(13-16)33-4/h8-15H,6-7H2,1-5H3,(H,27,31)(H2,25,26,28,29,30) |
| InChIKey | KZXBIVBKOGDNQW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |