C23H23F3N6O5 — CID 58711991
2-[(2,2,2-trifluoroacetyl)amino]-N-[1-[3-(3,4,5-trimethoxyanilino)-1,2,4-triazin-6-yl]ethyl]benzamide (PubChem CID 58711991) has the molecular formula C23H23F3N6O5 and a molecular weight of 520.47 g/mol. Its IUPAC name is 2-[(2,2,2-trifluoroacetyl)amino]-N-[1-[3-(3,4,5-trimethoxyanilino)-1,2,4-triazin-6-yl]ethyl]benzamide.
| Compound Name | 2-[(2,2,2-trifluoroacetyl)amino]-N-[1-[3-(3,4,5-trimethoxyanilino)-1,2,4-triazin-6-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 58711991 |
| Molecular Formula | C23H23F3N6O5 |
| Molecular Weight | 520.47 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 2-[(2,2,2-trifluoroacetyl)amino]-N-[1-[3-(3,4,5-trimethoxyanilino)-1,2,4-triazin-6-yl]ethyl]benzamide |
| SMILES | COc1cc(Nc2ncc(C(C)NC(=O)c3ccccc3NC(=O)C(F)(F)F)nn2)cc(OC)c1OC |
| InChI | InChI=1S/C23H23F3N6O5/c1-12(28-20(33)14-7-5-6-8-15(14)30-21(34)23(24,25)26)16-11-27-22(32-31-16)29-13-9-17(35-2)19(37-4)18(10-13)36-3/h5-12H,1-4H3,(H,28,33)(H,30,34)(H,27,29,32) |
| InChIKey | ODVGDAOZPVDJPN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |