C12H14F3NO3Si — CID 91719281
trimethylsilyl 2-[(2,2,2-trifluoroacetyl)amino]benzoate (PubChem CID 91719281) has the molecular formula C12H14F3NO3Si and a molecular weight of 305.33 g/mol. Its IUPAC name is trimethylsilyl 2-[(2,2,2-trifluoroacetyl)amino]benzoate.
| Compound Name | trimethylsilyl 2-[(2,2,2-trifluoroacetyl)amino]benzoate |
|---|---|
| PubChem CID | 91719281 |
| Molecular Formula | C12H14F3NO3Si |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | trimethylsilyl 2-[(2,2,2-trifluoroacetyl)amino]benzoate |
| SMILES | C[Si](C)(C)OC(=O)c1ccccc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C12H14F3NO3Si/c1-20(2,3)19-10(17)8-6-4-5-7-9(8)16-11(18)12(13,14)15/h4-7H,1-3H3,(H,16,18) |
| InChIKey | AOIBALIHOKJKLI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|