C15H10F3NO3 — CID 141410053
2,2,2-trifluoro-N-[2-[(E)-3-(furan-2-yl)prop-2-enoyl]phenyl]acetamide (PubChem CID 141410053) has the molecular formula C15H10F3NO3 and a molecular weight of 309.24 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-[(E)-3-(furan-2-yl)prop-2-enoyl]phenyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-[(E)-3-(furan-2-yl)prop-2-enoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 141410053 |
| Molecular Formula | C15H10F3NO3 |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-[(E)-3-(furan-2-yl)prop-2-enoyl]phenyl]acetamide |
| SMILES | O=C(/C=C/c1ccco1)c1ccccc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C15H10F3NO3/c16-15(17,18)14(21)19-12-6-2-1-5-11(12)13(20)8-7-10-4-3-9-22-10/h1-9H,(H,19,21)/b8-7+ |
| InChIKey | YFSQTEDMSMVIAL-BQYQJAHWSA-N |
| XLogP | 3.68 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|