C11H11Cl2NO3 — CID 10660048
methyl 2-(2,2-dichloropropanoylamino)benzoate (PubChem CID 10660048) has the molecular formula C11H11Cl2NO3 and a molecular weight of 276.12 g/mol. Its IUPAC name is methyl 2-(2,2-dichloropropanoylamino)benzoate.
| Compound Name | methyl 2-(2,2-dichloropropanoylamino)benzoate |
|---|---|
| PubChem CID | 10660048 |
| Molecular Formula | C11H11Cl2NO3 |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | methyl 2-(2,2-dichloropropanoylamino)benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C(C)(Cl)Cl |
| InChI | InChI=1S/C11H11Cl2NO3/c1-11(12,13)10(16)14-8-6-4-3-5-7(8)9(15)17-2/h3-6H,1-2H3,(H,14,16) |
| InChIKey | FNOCPRGIBPPNTF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|