C20H22N2O4 — CID 108967382
methyl 2-[[2,2-dimethyl-3-(3-methylanilino)-3-oxopropanoyl]amino]benzoate (PubChem CID 108967382) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is methyl 2-[[2,2-dimethyl-3-(3-methylanilino)-3-oxopropanoyl]amino]benzoate.
| Compound Name | methyl 2-[[2,2-dimethyl-3-(3-methylanilino)-3-oxopropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 108967382 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | methyl 2-[[2,2-dimethyl-3-(3-methylanilino)-3-oxopropanoyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C(C)(C)C(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C20H22N2O4/c1-13-8-7-9-14(12-13)21-18(24)20(2,3)19(25)22-16-11-6-5-10-15(16)17(23)26-4/h5-12H,1-4H3,(H,21,24)(H,22,25) |
| InChIKey | ILWKUEFQISFQAB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|