C17H19Cl2NO2Si — CID 618075
trimethylsilyl 2-(2,6-dichloro-4-methylanilino)benzoate (PubChem CID 618075) has the molecular formula C17H19Cl2NO2Si and a molecular weight of 368.34 g/mol. Its IUPAC name is trimethylsilyl 2-(2,6-dichloro-4-methylanilino)benzoate.
| Compound Name | trimethylsilyl 2-(2,6-dichloro-4-methylanilino)benzoate |
|---|---|
| PubChem CID | 618075 |
| Molecular Formula | C17H19Cl2NO2Si |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | trimethylsilyl 2-(2,6-dichloro-4-methylanilino)benzoate |
| SMILES | Cc1cc(Cl)c(Nc2ccccc2C(=O)O[Si](C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C17H19Cl2NO2Si/c1-11-9-13(18)16(14(19)10-11)20-15-8-6-5-7-12(15)17(21)22-23(2,3)4/h5-10,20H,1-4H3 |
| InChIKey | ZDKAISAWAFKTTJ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|