C18H19ClN2O3 — CID 108991922
ethyl 2-[(2-chloro-4,6-dimethylphenyl)carbamoylamino]benzoate (PubChem CID 108991922) has the molecular formula C18H19ClN2O3 and a molecular weight of 346.81 g/mol. Its IUPAC name is ethyl 2-[(2-chloro-4,6-dimethylphenyl)carbamoylamino]benzoate.
| Compound Name | ethyl 2-[(2-chloro-4,6-dimethylphenyl)carbamoylamino]benzoate |
|---|---|
| PubChem CID | 108991922 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | ethyl 2-[(2-chloro-4,6-dimethylphenyl)carbamoylamino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)Nc1c(C)cc(C)cc1Cl |
| InChI | InChI=1S/C18H19ClN2O3/c1-4-24-17(22)13-7-5-6-8-15(13)20-18(23)21-16-12(3)9-11(2)10-14(16)19/h5-10H,4H2,1-3H3,(H2,20,21,23) |
| InChIKey | GZHGRKDAQVTRQV-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |