C20H22ClNO4 — CID 2969501
ethyl 2-[2-(4-chloro-3,5-dimethylphenoxy)propanoylamino]benzoate (PubChem CID 2969501) has the molecular formula C20H22ClNO4 and a molecular weight of 375.85 g/mol. Its IUPAC name is ethyl 2-[2-(4-chloro-3,5-dimethylphenoxy)propanoylamino]benzoate.
| Compound Name | ethyl 2-[2-(4-chloro-3,5-dimethylphenoxy)propanoylamino]benzoate |
|---|---|
| PubChem CID | 2969501 |
| Molecular Formula | C20H22ClNO4 |
| Molecular Weight | 375.85 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | ethyl 2-[2-(4-chloro-3,5-dimethylphenoxy)propanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)C(C)Oc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C20H22ClNO4/c1-5-25-20(24)16-8-6-7-9-17(16)22-19(23)14(4)26-15-10-12(2)18(21)13(3)11-15/h6-11,14H,5H2,1-4H3,(H,22,23) |
| InChIKey | CZYICRHMGLPPLW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.85 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |