C20H23NO4 — CID 92685092
ethyl 2-[[(2S)-2-(2-ethylphenoxy)propanoyl]amino]benzoate (PubChem CID 92685092) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is ethyl 2-[[(2S)-2-(2-ethylphenoxy)propanoyl]amino]benzoate.
| Compound Name | ethyl 2-[[(2S)-2-(2-ethylphenoxy)propanoyl]amino]benzoate |
|---|---|
| PubChem CID | 92685092 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | ethyl 2-[[(2S)-2-(2-ethylphenoxy)propanoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)[C@H](C)Oc1ccccc1CC |
| InChI | InChI=1S/C20H23NO4/c1-4-15-10-6-9-13-18(15)25-14(3)19(22)21-17-12-8-7-11-16(17)20(23)24-5-2/h6-14H,4-5H2,1-3H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | UUISLRZMXGIBCN-AWEZNQCLSA-N |
| XLogP | 3.83 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |