C18H16Cl3NO4 — CID 1019527
ethyl 2-[[(2S)-2-(2,4,5-trichlorophenoxy)propanoyl]amino]benzoate (PubChem CID 1019527) has the molecular formula C18H16Cl3NO4 and a molecular weight of 416.69 g/mol. Its IUPAC name is ethyl 2-[[(2S)-2-(2,4,5-trichlorophenoxy)propanoyl]amino]benzoate.
| Compound Name | ethyl 2-[[(2S)-2-(2,4,5-trichlorophenoxy)propanoyl]amino]benzoate |
|---|---|
| PubChem CID | 1019527 |
| Molecular Formula | C18H16Cl3NO4 |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | ethyl 2-[[(2S)-2-(2,4,5-trichlorophenoxy)propanoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)[C@H](C)Oc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H16Cl3NO4/c1-3-25-18(24)11-6-4-5-7-15(11)22-17(23)10(2)26-16-9-13(20)12(19)8-14(16)21/h4-10H,3H2,1-2H3,(H,22,23)/t10-/m0/s1 |
| InChIKey | RSIAPRXHHBRYCX-JTQLQIEISA-N |
| XLogP | 5.23 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|