C23H29BrN6O3 — CID 142948626
3-bromo-N-[[3-(3,4-dimethoxy-5-methylanilino)-1,2,4-triazin-6-yl]-(methylamino)methyl]benzamide;ethane (PubChem CID 142948626) has the molecular formula C23H29BrN6O3 and a molecular weight of 517.43 g/mol. Its IUPAC name is 3-bromo-N-[[3-(3,4-dimethoxy-5-methylanilino)-1,2,4-triazin-6-yl]-(methylamino)methyl]benzamide;ethane.
| Compound Name | 3-bromo-N-[[3-(3,4-dimethoxy-5-methylanilino)-1,2,4-triazin-6-yl]-(methylamino)methyl]benzamide;ethane |
|---|---|
| PubChem CID | 142948626 |
| Molecular Formula | C23H29BrN6O3 |
| Molecular Weight | 517.43 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | 3-bromo-N-[[3-(3,4-dimethoxy-5-methylanilino)-1,2,4-triazin-6-yl]-(methylamino)methyl]benzamide;ethane |
| SMILES | CC.CNC(NC(=O)c1cccc(Br)c1)c1cnc(Nc2cc(C)c(OC)c(OC)c2)nn1 |
| InChI | InChI=1S/C21H23BrN6O3.C2H6/c1-12-8-15(10-17(30-3)18(12)31-4)25-21-24-11-16(27-28-21)19(23-2)26-20(29)13-6-5-7-14(22)9-13;1-2/h5-11,19,23H,1-4H3,(H,26,29)(H,24,25,28);1-2H3 |
| InChIKey | HOUDXDMQYVPSQX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|