C21H20N6O3S — CID 23536645
2-N-(4-phenyl-1,3-thiazol-2-yl)-4-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 23536645) has the molecular formula C21H20N6O3S and a molecular weight of 436.50 g/mol. Its IUPAC name is 2-N-(4-phenyl-1,3-thiazol-2-yl)-4-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(4-phenyl-1,3-thiazol-2-yl)-4-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 23536645 |
| Molecular Formula | C21H20N6O3S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 2-N-(4-phenyl-1,3-thiazol-2-yl)-4-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | COc1cc(Nc2ncnc(Nc3nc(-c4ccccc4)cs3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C21H20N6O3S/c1-28-16-9-14(10-17(29-2)18(16)30-3)24-19-22-12-23-20(26-19)27-21-25-15(11-31-21)13-7-5-4-6-8-13/h4-12H,1-3H3,(H2,22,23,24,25,26,27) |
| InChIKey | MUEPJCDZXOOINR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |