C21H23N5O5 — CID 59145704
4-(3-methoxyanilino)-2-(3,4,5-trimethoxyanilino)pyrimidine-5-carboxamide (PubChem CID 59145704) has the molecular formula C21H23N5O5 and a molecular weight of 425.45 g/mol. Its IUPAC name is 4-(3-methoxyanilino)-2-(3,4,5-trimethoxyanilino)pyrimidine-5-carboxamide.
| Compound Name | 4-(3-methoxyanilino)-2-(3,4,5-trimethoxyanilino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 59145704 |
| Molecular Formula | C21H23N5O5 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 4-(3-methoxyanilino)-2-(3,4,5-trimethoxyanilino)pyrimidine-5-carboxamide |
| SMILES | COc1cccc(Nc2nc(Nc3cc(OC)c(OC)c(OC)c3)ncc2C(N)=O)c1 |
| InChI | InChI=1S/C21H23N5O5/c1-28-14-7-5-6-12(8-14)24-20-15(19(22)27)11-23-21(26-20)25-13-9-16(29-2)18(31-4)17(10-13)30-3/h5-11H,1-4H3,(H2,22,27)(H2,23,24,25,26) |
| InChIKey | CIJXRZIUOVXTHH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |