C20H21N5O3 — CID 71237726
4-anilino-2-[(2,3-dimethoxyphenyl)methylamino]pyrimidine-5-carboxamide (PubChem CID 71237726) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is 4-anilino-2-[(2,3-dimethoxyphenyl)methylamino]pyrimidine-5-carboxamide.
| Compound Name | 4-anilino-2-[(2,3-dimethoxyphenyl)methylamino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 71237726 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 4-anilino-2-[(2,3-dimethoxyphenyl)methylamino]pyrimidine-5-carboxamide |
| SMILES | COc1cccc(CNc2ncc(C(N)=O)c(Nc3ccccc3)n2)c1OC |
| InChI | InChI=1S/C20H21N5O3/c1-27-16-10-6-7-13(17(16)28-2)11-22-20-23-12-15(18(21)26)19(25-20)24-14-8-4-3-5-9-14/h3-10,12H,11H2,1-2H3,(H2,21,26)(H2,22,23,24,25) |
| InChIKey | SONJYRJERDHSEV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |