C16H21N7O3 — CID 67002750
2-(2-aminopropylamino)-4-(4-carbamoyl-3-methoxyanilino)pyrimidine-5-carboxamide (PubChem CID 67002750) has the molecular formula C16H21N7O3 and a molecular weight of 359.39 g/mol. Its IUPAC name is 2-(2-aminopropylamino)-4-(4-carbamoyl-3-methoxyanilino)pyrimidine-5-carboxamide.
| Compound Name | 2-(2-aminopropylamino)-4-(4-carbamoyl-3-methoxyanilino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 67002750 |
| Molecular Formula | C16H21N7O3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 2-(2-aminopropylamino)-4-(4-carbamoyl-3-methoxyanilino)pyrimidine-5-carboxamide |
| SMILES | COc1cc(Nc2nc(NCC(C)N)ncc2C(N)=O)ccc1C(N)=O |
| InChI | InChI=1S/C16H21N7O3/c1-8(17)6-20-16-21-7-11(14(19)25)15(23-16)22-9-3-4-10(13(18)24)12(5-9)26-2/h3-5,7-8H,6,17H2,1-2H3,(H2,18,24)(H2,19,25)(H2,20,21,22,23) |
| InChIKey | IDGJXUPMYCVIBZ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 171.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |