C18H22N8O2 — CID 67002769
2-[(2-amino-3-methoxypropyl)amino]-4-(3-pyrazol-1-ylanilino)pyrimidine-5-carboxamide (PubChem CID 67002769) has the molecular formula C18H22N8O2 and a molecular weight of 382.43 g/mol. Its IUPAC name is 2-[(2-amino-3-methoxypropyl)amino]-4-(3-pyrazol-1-ylanilino)pyrimidine-5-carboxamide.
| Compound Name | 2-[(2-amino-3-methoxypropyl)amino]-4-(3-pyrazol-1-ylanilino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 67002769 |
| Molecular Formula | C18H22N8O2 |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 2-[(2-amino-3-methoxypropyl)amino]-4-(3-pyrazol-1-ylanilino)pyrimidine-5-carboxamide |
| SMILES | COCC(N)CNc1ncc(C(N)=O)c(Nc2cccc(-n3cccn3)c2)n1 |
| InChI | InChI=1S/C18H22N8O2/c1-28-11-12(19)9-21-18-22-10-15(16(20)27)17(25-18)24-13-4-2-5-14(8-13)26-7-3-6-23-26/h2-8,10,12H,9,11,19H2,1H3,(H2,20,27)(H2,21,22,24,25) |
| InChIKey | SLOLYWDURBNKCB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 146.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |