C16H18N8OS — CID 59199697
2-[[(2S)-2-aminopropyl]amino]-4-[4-(thiadiazol-4-yl)anilino]pyrimidine-5-carboxamide (PubChem CID 59199697) has the molecular formula C16H18N8OS and a molecular weight of 370.44 g/mol. Its IUPAC name is 2-[[(2S)-2-aminopropyl]amino]-4-[4-(thiadiazol-4-yl)anilino]pyrimidine-5-carboxamide.
| Compound Name | 2-[[(2S)-2-aminopropyl]amino]-4-[4-(thiadiazol-4-yl)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 59199697 |
| Molecular Formula | C16H18N8OS |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 2-[[(2S)-2-aminopropyl]amino]-4-[4-(thiadiazol-4-yl)anilino]pyrimidine-5-carboxamide |
| SMILES | C[C@H](N)CNc1ncc(C(N)=O)c(Nc2ccc(-c3csnn3)cc2)n1 |
| InChI | InChI=1S/C16H18N8OS/c1-9(17)6-19-16-20-7-12(14(18)25)15(22-16)21-11-4-2-10(3-5-11)13-8-26-24-23-13/h2-5,7-9H,6,17H2,1H3,(H2,18,25)(H2,19,20,21,22)/t9-/m0/s1 |
| InChIKey | CTDKIGSNDCBCML-VIFPVBQESA-N |
| XLogP | 1.60 |
| TPSA | 144.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |