C25H33BrN6O2S — CID 143003186
5-bromo-2-N-[5-[4-[ethyl(methyl)amino]butoxy]-2-methoxyphenyl]-4-N-[2-(methylaminosulfanyl)phenyl]pyrimidine-2,4-diamine (PubChem CID 143003186) has the molecular formula C25H33BrN6O2S and a molecular weight of 561.55 g/mol. Its IUPAC name is 5-bromo-2-N-[5-[4-[ethyl(methyl)amino]butoxy]-2-methoxyphenyl]-4-N-[2-(methylaminosulfanyl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 5-bromo-2-N-[5-[4-[ethyl(methyl)amino]butoxy]-2-methoxyphenyl]-4-N-[2-(methylaminosulfanyl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 143003186 |
| Molecular Formula | C25H33BrN6O2S |
| Molecular Weight | 561.55 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | 5-bromo-2-N-[5-[4-[ethyl(methyl)amino]butoxy]-2-methoxyphenyl]-4-N-[2-(methylaminosulfanyl)phenyl]pyrimidine-2,4-diamine |
| SMILES | CCN(C)CCCCOc1ccc(OC)c(Nc2ncc(Br)c(Nc3ccccc3SNC)n2)c1 |
| InChI | InChI=1S/C25H33BrN6O2S/c1-5-32(3)14-8-9-15-34-18-12-13-22(33-4)21(16-18)30-25-28-17-19(26)24(31-25)29-20-10-6-7-11-23(20)35-27-2/h6-7,10-13,16-17,27H,5,8-9,14-15H2,1-4H3,(H2,28,29,30,31) |
| InChIKey | KGWMNNBOOXGSRH-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 83.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.55 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|