C21H24N6S — CID 162521119
4-N-(3-aminophenyl)-5-methyl-2-N-(3-pyrrolidin-1-ylsulfanylphenyl)pyrimidine-2,4-diamine (PubChem CID 162521119) has the molecular formula C21H24N6S and a molecular weight of 392.53 g/mol. Its IUPAC name is 4-N-(3-aminophenyl)-5-methyl-2-N-(3-pyrrolidin-1-ylsulfanylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-aminophenyl)-5-methyl-2-N-(3-pyrrolidin-1-ylsulfanylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 162521119 |
| Molecular Formula | C21H24N6S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 4-N-(3-aminophenyl)-5-methyl-2-N-(3-pyrrolidin-1-ylsulfanylphenyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cnc(Nc2cccc(SN3CCCC3)c2)nc1Nc1cccc(N)c1 |
| InChI | InChI=1S/C21H24N6S/c1-15-14-23-21(26-20(15)24-17-7-4-6-16(22)12-17)25-18-8-5-9-19(13-18)28-27-10-2-3-11-27/h4-9,12-14H,2-3,10-11,22H2,1H3,(H2,23,24,25,26) |
| InChIKey | FFPUDKBGGGDWDV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|