C27H35N5O2S — CID 145207967
N-[3-(tert-butylamino)sulfanylphenyl]-5-methyl-2-[4-(2-pyrrolidin-1-ylethoxy)phenoxy]pyrimidin-4-amine (PubChem CID 145207967) has the molecular formula C27H35N5O2S and a molecular weight of 493.68 g/mol. Its IUPAC name is N-[3-(tert-butylamino)sulfanylphenyl]-5-methyl-2-[4-(2-pyrrolidin-1-ylethoxy)phenoxy]pyrimidin-4-amine.
| Compound Name | N-[3-(tert-butylamino)sulfanylphenyl]-5-methyl-2-[4-(2-pyrrolidin-1-ylethoxy)phenoxy]pyrimidin-4-amine |
|---|---|
| PubChem CID | 145207967 |
| Molecular Formula | C27H35N5O2S |
| Molecular Weight | 493.68 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | N-[3-(tert-butylamino)sulfanylphenyl]-5-methyl-2-[4-(2-pyrrolidin-1-ylethoxy)phenoxy]pyrimidin-4-amine |
| SMILES | Cc1cnc(Oc2ccc(OCCN3CCCC3)cc2)nc1Nc1cccc(SNC(C)(C)C)c1 |
| InChI | InChI=1S/C27H35N5O2S/c1-20-19-28-26(30-25(20)29-21-8-7-9-24(18-21)35-31-27(2,3)4)34-23-12-10-22(11-13-23)33-17-16-32-14-5-6-15-32/h7-13,18-19,31H,5-6,14-17H2,1-4H3,(H,28,29,30) |
| InChIKey | GKWBUGBWATWIOY-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.68 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|