C27H36N6O3S — CID 153456228
3-[[2-[4-(2-deuterio-2-pyrrolidin-1-ylethoxy)anilino]-5-methylpyrimidin-4-yl]amino]-N-(1,1,1,3,3,3-hexadeuterio-2-methylpropan-2-yl)benzenesulfonamide (PubChem CID 153456228) has the molecular formula C27H36N6O3S and a molecular weight of 531.73 g/mol. Its IUPAC name is 3-[[2-[4-(2-deuterio-2-pyrrolidin-1-ylethoxy)anilino]-5-methylpyrimidin-4-yl]amino]-N-(1,1,1,3,3,3-hexadeuterio-2-methylpropan-2-yl)benzenesulfonamide.
| Compound Name | 3-[[2-[4-(2-deuterio-2-pyrrolidin-1-ylethoxy)anilino]-5-methylpyrimidin-4-yl]amino]-N-(1,1,1,3,3,3-hexadeuterio-2-methylpropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 153456228 |
| Molecular Formula | C27H36N6O3S |
| Molecular Weight | 531.73 g/mol |
| Exact Mass | 531.30 |
| IUPAC Name | 3-[[2-[4-(2-deuterio-2-pyrrolidin-1-ylethoxy)anilino]-5-methylpyrimidin-4-yl]amino]-N-(1,1,1,3,3,3-hexadeuterio-2-methylpropan-2-yl)benzenesulfonamide |
| SMILES | [2H]C(COc1ccc(Nc2ncc(C)c(Nc3cccc(S(=O)(=O)NC(C)(C([2H])([2H])[2H])C([2H])([2H])[2H])c3)n2)cc1)N1CCCC1 |
| InChI | InChI=1S/C27H36N6O3S/c1-20-19-28-26(30-21-10-12-23(13-11-21)36-17-16-33-14-5-6-15-33)31-25(20)29-22-8-7-9-24(18-22)37(34,35)32-27(2,3)4/h7-13,18-19,32H,5-6,14-17H2,1-4H3,(H2,28,29,30,31)/i2D3,3D3,16D |
| InChIKey | JOOXLOJCABQBSG-PTWMKCHPSA-N |
| XLogP | 4.82 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.73 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |