C26H35N7O4S — CID 142534830
1-[3-[4-[[4-[3-(tert-butylsulfamoyl)anilino]-5-methylpyrimidin-2-yl]amino]phenoxy]propyl]-3-methylurea (PubChem CID 142534830) has the molecular formula C26H35N7O4S and a molecular weight of 541.68 g/mol. Its IUPAC name is 1-[3-[4-[[4-[3-(tert-butylsulfamoyl)anilino]-5-methylpyrimidin-2-yl]amino]phenoxy]propyl]-3-methylurea.
| Compound Name | 1-[3-[4-[[4-[3-(tert-butylsulfamoyl)anilino]-5-methylpyrimidin-2-yl]amino]phenoxy]propyl]-3-methylurea |
|---|---|
| PubChem CID | 142534830 |
| Molecular Formula | C26H35N7O4S |
| Molecular Weight | 541.68 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | 1-[3-[4-[[4-[3-(tert-butylsulfamoyl)anilino]-5-methylpyrimidin-2-yl]amino]phenoxy]propyl]-3-methylurea |
| SMILES | CNC(=O)NCCCOc1ccc(Nc2ncc(C)c(Nc3cccc(S(=O)(=O)NC(C)(C)C)c3)n2)cc1 |
| InChI | InChI=1S/C26H35N7O4S/c1-18-17-29-24(31-19-10-12-21(13-11-19)37-15-7-14-28-25(34)27-5)32-23(18)30-20-8-6-9-22(16-20)38(35,36)33-26(2,3)4/h6,8-13,16-17,33H,7,14-15H2,1-5H3,(H2,27,28,34)(H2,29,30,31,32) |
| InChIKey | BXOFPWUPIFKWNJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 146.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.68 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|