C15H21N5O2S — CID 66647791
3-[(2-amino-5-methylpyrimidin-4-yl)amino]-N-tert-butylbenzenesulfonamide (PubChem CID 66647791) has the molecular formula C15H21N5O2S and a molecular weight of 335.43 g/mol. Its IUPAC name is 3-[(2-amino-5-methylpyrimidin-4-yl)amino]-N-tert-butylbenzenesulfonamide.
| Compound Name | 3-[(2-amino-5-methylpyrimidin-4-yl)amino]-N-tert-butylbenzenesulfonamide |
|---|---|
| PubChem CID | 66647791 |
| Molecular Formula | C15H21N5O2S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 3-[(2-amino-5-methylpyrimidin-4-yl)amino]-N-tert-butylbenzenesulfonamide |
| SMILES | Cc1cnc(N)nc1Nc1cccc(S(=O)(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C15H21N5O2S/c1-10-9-17-14(16)19-13(10)18-11-6-5-7-12(8-11)23(21,22)20-15(2,3)4/h5-9,20H,1-4H3,(H3,16,17,18,19) |
| InChIKey | FNVOEHBTXAFODP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |