About N-tert-butyl-5-[(2,5-dimethylpyrimidin-4-yl)amino]-2-methylbenzenesulfonamide
N-tert-butyl-5-[(2,5-dimethylpyrimidin-4-yl)amino]-2-methylbenzenesulfonamide (PubChem CID 145296716) has the molecular formula C17H24N4O2S
and a molecular weight of 348.47 g/mol. Its IUPAC name is N-tert-butyl-5-[(2,5-dimethylpyrimidin-4-yl)amino]-2-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-tert-butyl-5-[(2,5-dimethylpyrimidin-4-yl)amino]-2-methylbenzenesulfonamide |
| PubChem CID | 145296716 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-tert-butyl-5-[(2,5-dimethylpyrimidin-4-yl)amino]-2-methylbenzenesulfonamide |
| SMILES | Cc1ncc(C)c(Nc2ccc(C)c(S(=O)(=O)NC(C)(C)C)c2)n1 |
| InChI | InChI=1S/C17H24N4O2S/c1-11-7-8-14(20-16-12(2)10-18-13(3)19-16)9-15(11)24(22,23)21-17(4,5)6/h7-10,21H,1-6H3,(H,18,19,20) |
| InChIKey | HUSQWHIDYMBJCU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-tert-butyl-5-[(2,5-dimethylpyrimidin-4-yl)amino]-2-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-5-[(2,5-dimethylpyrimidin-4-yl)amino]-2-methylbenzenesulfonamide?
The IUPAC name of N-tert-butyl-5-[(2,5-dimethylpyrimidin-4-yl)amino]-2-methylbenzenesulfonamide (CID 145296716) is N-tert-butyl-5-[(2,5-dimethylpyrimidin-4-yl)amino]-2-methylbenzenesulfonamide.
What is the SMILES notation for N-tert-butyl-5-[(2,5-dimethylpyrimidin-4-yl)amino]-2-methylbenzenesulfonamide?
The canonical SMILES for N-tert-butyl-5-[(2,5-dimethylpyrimidin-4-yl)amino]-2-methylbenzenesulfonamide is Cc1ncc(C)c(Nc2ccc(C)c(S(=O)(=O)NC(C)(C)C)c2)n1.
What is the InChIKey of N-tert-butyl-5-[(2,5-dimethylpyrimidin-4-yl)amino]-2-methylbenzenesulfonamide?
The InChIKey is HUSQWHIDYMBJCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4O2S/c1-11-7-8-14(20-16-12(2)10-18-13(3)19-16)9-15(11)24(22,23)21-17(4,5)6/h7-10,21H,1-6H3,(H,18,19,20).
What are the key properties of N-tert-butyl-5-[(2,5-dimethylpyrimidin-4-yl)amino]-2-methylbenzenesulfonamide?
N-tert-butyl-5-[(2,5-dimethylpyrimidin-4-yl)amino]-2-methylbenzenesulfonamide has a molecular weight of 348.47 g/mol, XLogP of 3.22, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-5-[(2,5-dimethylpyrimidin-4-yl)amino]-2-methylbenzenesulfonamide is sourced from PubChem (CID 145296716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).