C18H17ClN2S2 — CID 122183985
4-(3-chlorophenyl)-N-(3-propylsulfanylphenyl)-1,3-thiazol-2-amine (PubChem CID 122183985) has the molecular formula C18H17ClN2S2 and a molecular weight of 360.94 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-N-(3-propylsulfanylphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(3-chlorophenyl)-N-(3-propylsulfanylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 122183985 |
| Molecular Formula | C18H17ClN2S2 |
| Molecular Weight | 360.94 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 4-(3-chlorophenyl)-N-(3-propylsulfanylphenyl)-1,3-thiazol-2-amine |
| SMILES | CCCSc1cccc(Nc2nc(-c3cccc(Cl)c3)cs2)c1 |
| InChI | InChI=1S/C18H17ClN2S2/c1-2-9-22-16-8-4-7-15(11-16)20-18-21-17(12-23-18)13-5-3-6-14(19)10-13/h3-8,10-12H,2,9H2,1H3,(H,20,21) |
| InChIKey | QZYQVNXBDBRKOR-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.94 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |