About (3-phenoxyphenyl)methyl 4-pyrazin-2-ylpiperazine-1-carboxylate
(3-phenoxyphenyl)methyl 4-pyrazin-2-ylpiperazine-1-carboxylate (PubChem CID 6735256) has the molecular formula C22H22N4O3
and a molecular weight of 390.44 g/mol. Its IUPAC name is (3-phenoxyphenyl)methyl 4-pyrazin-2-ylpiperazine-1-carboxylate.
Molecular Properties
| Compound Name | (3-phenoxyphenyl)methyl 4-pyrazin-2-ylpiperazine-1-carboxylate |
| PubChem CID | 6735256 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (3-phenoxyphenyl)methyl 4-pyrazin-2-ylpiperazine-1-carboxylate |
| SMILES | O=C(OCc1cccc(Oc2ccccc2)c1)N1CCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C22H22N4O3/c27-22(26-13-11-25(12-14-26)21-16-23-9-10-24-21)28-17-18-5-4-8-20(15-18)29-19-6-2-1-3-7-19/h1-10,15-16H,11-14,17H2 |
| InChIKey | JPDKSRYZTAPRBT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-phenoxyphenyl)methyl 4-pyrazin-2-ylpiperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenoxyphenyl)methyl 4-pyrazin-2-ylpiperazine-1-carboxylate?
The IUPAC name of (3-phenoxyphenyl)methyl 4-pyrazin-2-ylpiperazine-1-carboxylate (CID 6735256) is (3-phenoxyphenyl)methyl 4-pyrazin-2-ylpiperazine-1-carboxylate.
What is the SMILES notation for (3-phenoxyphenyl)methyl 4-pyrazin-2-ylpiperazine-1-carboxylate?
The canonical SMILES for (3-phenoxyphenyl)methyl 4-pyrazin-2-ylpiperazine-1-carboxylate is O=C(OCc1cccc(Oc2ccccc2)c1)N1CCN(c2cnccn2)CC1.
What is the InChIKey of (3-phenoxyphenyl)methyl 4-pyrazin-2-ylpiperazine-1-carboxylate?
The InChIKey is JPDKSRYZTAPRBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N4O3/c27-22(26-13-11-25(12-14-26)21-16-23-9-10-24-21)28-17-18-5-4-8-20(15-18)29-19-6-2-1-3-7-19/h1-10,15-16H,11-14,17H2.
What are the key properties of (3-phenoxyphenyl)methyl 4-pyrazin-2-ylpiperazine-1-carboxylate?
(3-phenoxyphenyl)methyl 4-pyrazin-2-ylpiperazine-1-carboxylate has a molecular weight of 390.44 g/mol, XLogP of 3.73, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenoxyphenyl)methyl 4-pyrazin-2-ylpiperazine-1-carboxylate is sourced from PubChem (CID 6735256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).