C13H15N3O2 — CID 46274751
N-(1,2-benzoxazol-3-ylmethyl)pyrrolidine-1-carboxamide (PubChem CID 46274751) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is N-(1,2-benzoxazol-3-ylmethyl)pyrrolidine-1-carboxamide.
| Compound Name | N-(1,2-benzoxazol-3-ylmethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 46274751 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | N-(1,2-benzoxazol-3-ylmethyl)pyrrolidine-1-carboxamide |
| SMILES | O=C(NCc1noc2ccccc12)N1CCCC1 |
| InChI | InChI=1S/C13H15N3O2/c17-13(16-7-3-4-8-16)14-9-11-10-5-1-2-6-12(10)18-15-11/h1-2,5-6H,3-4,7-9H2,(H,14,17) |
| InChIKey | DPNZYFGLTXERLR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |