C15H18N4O3 — CID 50757562
1-N-(1,2-benzoxazol-3-ylmethyl)piperidine-1,4-dicarboxamide (PubChem CID 50757562) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 1-N-(1,2-benzoxazol-3-ylmethyl)piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-(1,2-benzoxazol-3-ylmethyl)piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 50757562 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 1-N-(1,2-benzoxazol-3-ylmethyl)piperidine-1,4-dicarboxamide |
| SMILES | NC(=O)C1CCN(C(=O)NCc2noc3ccccc23)CC1 |
| InChI | InChI=1S/C15H18N4O3/c16-14(20)10-5-7-19(8-6-10)15(21)17-9-12-11-3-1-2-4-13(11)22-18-12/h1-4,10H,5-9H2,(H2,16,20)(H,17,21) |
| InChIKey | OCLBNZLZRBCIGD-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |