C19H19N3O2 — CID 20901384
N-(1,2-benzoxazol-3-ylmethyl)-3-phenylpyrrolidine-1-carboxamide (PubChem CID 20901384) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is N-(1,2-benzoxazol-3-ylmethyl)-3-phenylpyrrolidine-1-carboxamide.
| Compound Name | N-(1,2-benzoxazol-3-ylmethyl)-3-phenylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 20901384 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | N-(1,2-benzoxazol-3-ylmethyl)-3-phenylpyrrolidine-1-carboxamide |
| SMILES | O=C(NCc1noc2ccccc12)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C19H19N3O2/c23-19(20-12-17-16-8-4-5-9-18(16)24-21-17)22-11-10-15(13-22)14-6-2-1-3-7-14/h1-9,15H,10-13H2,(H,20,23) |
| InChIKey | QCCQZZSIVPAYLE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |