C16H21N3O2 — CID 20901318
3-(1,2-benzoxazol-3-ylmethyl)-1-cyclohexyl-1-methylurea (PubChem CID 20901318) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 3-(1,2-benzoxazol-3-ylmethyl)-1-cyclohexyl-1-methylurea.
| Compound Name | 3-(1,2-benzoxazol-3-ylmethyl)-1-cyclohexyl-1-methylurea |
|---|---|
| PubChem CID | 20901318 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 3-(1,2-benzoxazol-3-ylmethyl)-1-cyclohexyl-1-methylurea |
| SMILES | CN(C(=O)NCc1noc2ccccc12)C1CCCCC1 |
| InChI | InChI=1S/C16H21N3O2/c1-19(12-7-3-2-4-8-12)16(20)17-11-14-13-9-5-6-10-15(13)21-18-14/h5-6,9-10,12H,2-4,7-8,11H2,1H3,(H,17,20) |
| InChIKey | JLTVUTHNIHGXCE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |