C17H14N2O4 — CID 137064384
N-benzyl-2,3-dihydroxy-1-oxoisoquinoline-4-carboxamide (PubChem CID 137064384) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is N-benzyl-2,3-dihydroxy-1-oxoisoquinoline-4-carboxamide.
| Compound Name | N-benzyl-2,3-dihydroxy-1-oxoisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 137064384 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | N-benzyl-2,3-dihydroxy-1-oxoisoquinoline-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1c(O)n(O)c(=O)c2ccccc12 |
| InChI | InChI=1S/C17H14N2O4/c20-15(18-10-11-6-2-1-3-7-11)14-12-8-4-5-9-13(12)16(21)19(23)17(14)22/h1-9,22-23H,10H2,(H,18,20) |
| InChIKey | SPEBEOWSRVYTHD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|