C18H16N2O5 — CID 137031826
2,3-dihydroxy-N-[(4-methoxyphenyl)methyl]-1-oxoisoquinoline-4-carboxamide (PubChem CID 137031826) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is 2,3-dihydroxy-N-[(4-methoxyphenyl)methyl]-1-oxoisoquinoline-4-carboxamide.
| Compound Name | 2,3-dihydroxy-N-[(4-methoxyphenyl)methyl]-1-oxoisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 137031826 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2,3-dihydroxy-N-[(4-methoxyphenyl)methyl]-1-oxoisoquinoline-4-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2c(O)n(O)c(=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C18H16N2O5/c1-25-12-8-6-11(7-9-12)10-19-16(21)15-13-4-2-3-5-14(13)17(22)20(24)18(15)23/h2-9,23-24H,10H2,1H3,(H,19,21) |
| InChIKey | AIFPLKTVLFBDNH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|