C15H12Cl3NO3 — CID 112820912
2,3,5-trichloro-6-hydroxy-N-[(4-methoxyphenyl)methyl]benzamide (PubChem CID 112820912) has the molecular formula C15H12Cl3NO3 and a molecular weight of 360.62 g/mol. Its IUPAC name is 2,3,5-trichloro-6-hydroxy-N-[(4-methoxyphenyl)methyl]benzamide.
| Compound Name | 2,3,5-trichloro-6-hydroxy-N-[(4-methoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 112820912 |
| Molecular Formula | C15H12Cl3NO3 |
| Molecular Weight | 360.62 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | 2,3,5-trichloro-6-hydroxy-N-[(4-methoxyphenyl)methyl]benzamide |
| SMILES | COc1ccc(CNC(=O)c2c(O)c(Cl)cc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C15H12Cl3NO3/c1-22-9-4-2-8(3-5-9)7-19-15(21)12-13(18)10(16)6-11(17)14(12)20/h2-6,20H,7H2,1H3,(H,19,21) |
| InChIKey | AWTGXUPCDQWAHD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.62 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|