C18H18Cl3N3O3 — CID 112824262
2,3,5-trichloro-6-hydroxy-N-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]benzamide (PubChem CID 112824262) has the molecular formula C18H18Cl3N3O3 and a molecular weight of 430.72 g/mol. Its IUPAC name is 2,3,5-trichloro-6-hydroxy-N-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]benzamide.
| Compound Name | 2,3,5-trichloro-6-hydroxy-N-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 112824262 |
| Molecular Formula | C18H18Cl3N3O3 |
| Molecular Weight | 430.72 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | 2,3,5-trichloro-6-hydroxy-N-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]benzamide |
| SMILES | CC(C)NC(=O)Nc1ccc(CNC(=O)c2c(O)c(Cl)cc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C18H18Cl3N3O3/c1-9(2)23-18(27)24-11-5-3-10(4-6-11)8-22-17(26)14-15(21)12(19)7-13(20)16(14)25/h3-7,9,25H,8H2,1-2H3,(H,22,26)(H2,23,24,27) |
| InChIKey | ALSOAHRHTGFTMA-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.72 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|