C18H19ClIN3O2 — CID 46456497
4-chloro-3-iodo-N-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]benzamide (PubChem CID 46456497) has the molecular formula C18H19ClIN3O2 and a molecular weight of 471.73 g/mol. Its IUPAC name is 4-chloro-3-iodo-N-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]benzamide.
| Compound Name | 4-chloro-3-iodo-N-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 46456497 |
| Molecular Formula | C18H19ClIN3O2 |
| Molecular Weight | 471.73 g/mol |
| Exact Mass | 471.02 |
| IUPAC Name | 4-chloro-3-iodo-N-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]benzamide |
| SMILES | CC(C)NC(=O)Nc1ccc(CNC(=O)c2ccc(Cl)c(I)c2)cc1 |
| InChI | InChI=1S/C18H19ClIN3O2/c1-11(2)22-18(25)23-14-6-3-12(4-7-14)10-21-17(24)13-5-8-15(19)16(20)9-13/h3-9,11H,10H2,1-2H3,(H,21,24)(H2,22,23,25) |
| InChIKey | DUUJBHDKAPASRX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.73 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|