C19H19Cl3N2O3 — CID 112821498
2,3,5-trichloro-N-[[4-(diethylcarbamoyl)phenyl]methyl]-6-hydroxybenzamide (PubChem CID 112821498) has the molecular formula C19H19Cl3N2O3 and a molecular weight of 429.73 g/mol. Its IUPAC name is 2,3,5-trichloro-N-[[4-(diethylcarbamoyl)phenyl]methyl]-6-hydroxybenzamide.
| Compound Name | 2,3,5-trichloro-N-[[4-(diethylcarbamoyl)phenyl]methyl]-6-hydroxybenzamide |
|---|---|
| PubChem CID | 112821498 |
| Molecular Formula | C19H19Cl3N2O3 |
| Molecular Weight | 429.73 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 2,3,5-trichloro-N-[[4-(diethylcarbamoyl)phenyl]methyl]-6-hydroxybenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(CNC(=O)c2c(O)c(Cl)cc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C19H19Cl3N2O3/c1-3-24(4-2)19(27)12-7-5-11(6-8-12)10-23-18(26)15-16(22)13(20)9-14(21)17(15)25/h5-9,25H,3-4,10H2,1-2H3,(H,23,26) |
| InChIKey | CZMWKPZKZBIGLM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.73 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|