C17H16Cl3NO3 — CID 112821238
2,3,5-trichloro-N-[[2-(ethoxymethyl)phenyl]methyl]-6-hydroxybenzamide (PubChem CID 112821238) has the molecular formula C17H16Cl3NO3 and a molecular weight of 388.68 g/mol. Its IUPAC name is 2,3,5-trichloro-N-[[2-(ethoxymethyl)phenyl]methyl]-6-hydroxybenzamide.
| Compound Name | 2,3,5-trichloro-N-[[2-(ethoxymethyl)phenyl]methyl]-6-hydroxybenzamide |
|---|---|
| PubChem CID | 112821238 |
| Molecular Formula | C17H16Cl3NO3 |
| Molecular Weight | 388.68 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 2,3,5-trichloro-N-[[2-(ethoxymethyl)phenyl]methyl]-6-hydroxybenzamide |
| SMILES | CCOCc1ccccc1CNC(=O)c1c(O)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C17H16Cl3NO3/c1-2-24-9-11-6-4-3-5-10(11)8-21-17(23)14-15(20)12(18)7-13(19)16(14)22/h3-7,22H,2,8-9H2,1H3,(H,21,23) |
| InChIKey | CIMSZNLWQFOJGR-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.68 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|